CAS 53944-31-3 appears in our catalog under these names: Pranoprofen Impurity 1, 7-Ethyl-5-oxo-5H-(1)benzopyrano(2,3-b)pyridine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
7-ethylchromeno[2,3-b]pyridin-5-one (CAS 53944-31-3) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 7-ethylchromeno[2,3-b]pyridin-5-one. InChIKey: QJEREWAEAHLFGE-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 7-ethylchromeno[2,3-b]pyridin-5-one |
| InChIKey | QJEREWAEAHLFGE-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC3=C(C2=O)C=CC=N3 |
Computed by PubChem (NCBI)