CAS 64321-61-5 appears in our catalog under these names: Ethyl 4–hydroxy–6–isopropylquinoline–3–carboxylate, ethyl 4-oxo-6-(propan-2-yl)-1,4-dihydroquinoline-3-carboxylate, ethyl 6-isopropyl-4-oxo-1,4-dihydroquinoline-3-carboxylate. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylate (CAS 64321-61-5) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: ethyl 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylate. InChIKey: JBFFEVKDAYLOKF-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | ethyl 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylate |
| InChIKey | JBFFEVKDAYLOKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)C(C)C |
Computed by PubChem (NCBI)