CAS 54030-33-0 is the registry number for 6-Formyl-2,2-dimethyl-1,3-benzodioxan. Offered by: TRC. Available pack sizes: 1g.
2,2-dimethyl-4H-1,3-benzodioxine-6-carbaldehyde (CAS 54030-33-0) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2,2-dimethyl-4H-1,3-benzodioxine-6-carbaldehyde. InChIKey: KNGWEAQJZJKFLI-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2,2-dimethyl-4H-1,3-benzodioxine-6-carbaldehyde |
| InChIKey | KNGWEAQJZJKFLI-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C=O)C |
Computed by PubChem (NCBI)