CAS 540524-67-2 appears in our catalog under these names: (2,6-Dimethylphenyl)methanesulfonyl chloride, 95+%, (2,6-Dimethylphenyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(2,6-dimethylphenyl)methanesulfonyl chloride (CAS 540524-67-2) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: (2,6-dimethylphenyl)methanesulfonyl chloride. InChIKey: SLVJLZHMCFBLKO-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | (2,6-dimethylphenyl)methanesulfonyl chloride |
| InChIKey | SLVJLZHMCFBLKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)