Products 54090-41-4
CAS 54090-41-4 appears in our catalog under these names: 4-Methyl-2-nitrobenzene-1-sulfonyl chloride, 4-Methyl-2-nitrobenzene-1-sulfonyl chloride 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 10g.
4-methyl-2-nitrobenzenesulfonyl chloride (CAS 54090-41-4) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 4-methyl-2-nitrobenzenesulfonyl chloride. InChIKey: HEVNLMSJUFKWBS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 4-methyl-2-nitrobenzenesulfonyl chloride |
| InChIKey | HEVNLMSJUFKWBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-methyl-2-nitrobenzene-1-sulfonyl chloride, 2-Nitro-p-toluenesulphonyl chloride, 4-methyl-2-nitrobenzenesulfonyl chloride, 4-methyl-2-nitro-benzenesulfonyl chloride, Benzenesulfonylchloride, 4-methyl-2-nitro-, chloro(4-methyl-2-nitrophenyl)sulfone, 2-nitro-4-methylbenzenesulfonyl chloride, 4-methyl-2-nitrobenzene-1-sulfonylchloride, Benzenesulfonyl chloride, 4-methyl-2-nitro-