CAS 5417-17-4 appears in our catalog under these names: 2-Chloro-3,4-dimethoxybenzaldehyde, >95% (HPLC), 2–Chloro–3,4–dimethoxybenzaldehyde, 2-Chloro-3,4-dimethoxybenzaldehyde, >98.0%(GC), 2-Chloro-3,4-dimethoxybenzaldehyde 98%, 2-Chloro-3,4-dimethoxybenzaldehyde, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 10g, 500g, 250g.
2-chloro-3,4-dimethoxybenzaldehyde (CAS 5417-17-4) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-3,4-dimethoxybenzaldehyde. InChIKey: SAWHDJTZESXNMM-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-3,4-dimethoxybenzaldehyde |
| InChIKey | SAWHDJTZESXNMM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)Cl)OC |
Computed by PubChem (NCBI)