CAS 54197-64-7 appears in our catalog under these names: Cilostazol Impurity 4, 6-Methoxy-3,4-dihydroquinolin-2(1H)-one 97%, 6-Methoxy-2-oxo-1,2,3,4-tetrahydroquiniline, 98%. Offered by: Chemat Brand, Ambeed, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 25g, 10g.
6-methoxy-3,4-dihydro-1H-quinolin-2-one (CAS 54197-64-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-1H-quinolin-2-one. InChIKey: XHKXYVRULOMTOW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | XHKXYVRULOMTOW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)CC2 |
Computed by PubChem (NCBI)