CAS 5420-38-2 appears in our catalog under these names: 4-Formyl-2-methoxyphenyl 4-methoxybenzoate, 95%, 4-Formyl-2-methoxyphenyl 4-methoxybenzoate, 95%, 95%, 4-Methoxy-benzoic acid 4-formyl-2-methoxy-phenyl ester, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
(4-formyl-2-methoxyphenyl) 4-methoxybenzoate (CAS 5420-38-2) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 4-methoxybenzoate. InChIKey: VEHXKUNAGOJDJB-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 4-methoxybenzoate |
| InChIKey | VEHXKUNAGOJDJB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)