CAS 543708-58-3 is the registry number for tert–butyl (4–fluoro–3–nitrophenyl)carbamate. Offered by: GLPBio. Available pack sizes: 250mg.
N-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropanamide (CAS 543708-58-3) is a chemical compound with the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. IUPAC name: N-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropanamide. InChIKey: UNFBMIXQNNHAKT-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O3 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | N-(4-fluoro-3-nitrophenyl)-2,2-dimethylpropanamide |
| InChIKey | UNFBMIXQNNHAKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)