CAS 543713-43-5 is the registry number for 1-(3-Pyridin-3-ylisoxazol-5-yl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3-pyridin-3-yl-1,2-oxazol-5-yl)methanamine (CAS 543713-43-5) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: (3-pyridin-3-yl-1,2-oxazol-5-yl)methanamine. InChIKey: HQTBIZDUNOAXTD-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | (3-pyridin-3-yl-1,2-oxazol-5-yl)methanamine |
| InChIKey | HQTBIZDUNOAXTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NOC(=C2)CN |
Computed by PubChem (NCBI)