Products 54396-24-6
CAS 54396-24-6 is the registry number for Ethyl 6-methyl-2-oxo-2H-chromene-3-carboxylate, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Ethyl 6-methyl-2-oxochromene-3-carboxylate (CAS 54396-24-6) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 6-methyl-2-oxochromene-3-carboxylate. InChIKey: KSWKCZHIAJEFGQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | ethyl 6-methyl-2-oxochromene-3-carboxylate |
| InChIKey | KSWKCZHIAJEFGQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2)C)OC1=O |
Computed by PubChem (NCBI)