Products 544467-07-4
CAS 544467-07-4 appears in our catalog under these names: HIV–1 integrase inhibitor, HIV-1 integrase inhibitor, HIV-1 integrase inhibitor, 97.06%, HIV-1 integrase inhibitor, 96.37%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 200mg, 5mg, 50mg, 100mg, 250mg, 500mg, 10mM/1mL.
4-[3-(azidomethyl)phenyl]-4-hydroxy-2-oxobut-3-enoic acid (CAS 544467-07-4) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 4-[3-(azidomethyl)phenyl]-4-hydroxy-2-oxobut-3-enoic acid. InChIKey: ZIRLWIWYZCQZJW-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 4-[3-(azidomethyl)phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
| InChIKey | ZIRLWIWYZCQZJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=CC(=O)C(=O)O)O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)