Products 5456-18-8
CAS 5456-18-8 is the registry number for 2,6-di-tert-Butyl-4-(1-methoxyethyl)phenol, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2,6-ditert-butyl-4-(1-methoxyethyl)phenol (CAS 5456-18-8) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-(1-methoxyethyl)phenol. InChIKey: YWUVHLCPQKQMRU-UHFFFAOYSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(1-methoxyethyl)phenol |
| InChIKey | YWUVHLCPQKQMRU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)OC |
Computed by PubChem (NCBI)