CAS 5463-29-6 appears in our catalog under these names: 6–Bromo–2–oxo–1,2–dihydroquinoline–4–carboxylic acid, 6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 98%, 98%, 6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g, 10g, 25g, 50g.
6-bromo-2-oxo-1H-quinoline-4-carboxylic acid (CAS 5463-29-6) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 6-bromo-2-oxo-1H-quinoline-4-carboxylic acid. InChIKey: MSHIVFYFWJGDMA-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 6-bromo-2-oxo-1H-quinoline-4-carboxylic acid |
| InChIKey | MSHIVFYFWJGDMA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)