CAS 5465-65-6 appears in our catalog under these names: 4'–Chloro–3'–nitroacetophenone, 4-Chloro-3-nitroacetophenone/ 97+%, 4'-Chloro-3'-nitroacetophenone, >98.0%(GC), 4-Chloro-3-nitroacetophenone, 4-Chloro-3-nitroacetophenone 98%. Offered by: GLPBio, Chemat, TCI, Biosynth, Ambeed. Available pack sizes: 100g, 25g, 5g, 0,25kg, 0,1kg, 0,5kg, 10g, 500g.
1-(4-chloro-3-nitrophenyl)ethanone (CAS 5465-65-6) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)ethanone. InChIKey: YEVPHFIFGUWSMG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)ethanone |
| InChIKey | YEVPHFIFGUWSMG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)