Products 5467-99-2
CAS 5467-99-2 appears in our catalog under these names: Benzyl 4-methylbenzoate, 95%, Benzyl 4-methylbenzoate 95%, Benzyl 4-methylbenzoate, 97%, 97%, Benzyl 4-methylbenzoate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 100g.
Benzyl 4-methylbenzoate (CAS 5467-99-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: benzyl 4-methylbenzoate. InChIKey: LNXGEZSXCGDUSD-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | benzyl 4-methylbenzoate |
| InChIKey | LNXGEZSXCGDUSD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)