Products 54673-07-3
CAS 54673-07-3 appears in our catalog under these names: 2-Cyano-3-(3-hydroxyphenyl)acrylic acid 95+%, 2-Cyano-3-(3-hydroxyphenyl)acrylic acid, 95+%, 95+%, α–Cyano–3–hydroxycinnamic Acid, Alpha-cyano-3-hydroxycinnamic acid, 95%, alpha-Cyano-3-hydroxycinnamic Acid, >98.0%(HPLC)(T). Offered by: Ambeed, Chemat, GLPBio, Combi-blocks, TCI. Available pack sizes: 250mg, 1g, 5g, 25g.
2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid (CAS 54673-07-3) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid. InChIKey: HPLNTJVXWMJLNJ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | HPLNTJVXWMJLNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C=C(C#N)C(=O)O |
Computed by PubChem (NCBI)