CAS 5468-96-2 is the registry number for 2,4-Dichlorobenzyl acetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-dichlorophenyl)methyl acetate (CAS 5468-96-2) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: (2,4-dichlorophenyl)methyl acetate. InChIKey: TXJMBLACZHJNAE-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | (2,4-dichlorophenyl)methyl acetate |
| InChIKey | TXJMBLACZHJNAE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)