CAS 54920-80-8 is the registry number for 4-Chloro-1,2-dihydro-1,7-naphthyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-1H-1,7-naphthyridin-2-one (CAS 54920-80-8) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 4-chloro-1H-1,7-naphthyridin-2-one. InChIKey: MQNCKADAGOHTIL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 4-chloro-1H-1,7-naphthyridin-2-one |
| InChIKey | MQNCKADAGOHTIL-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=CC(=O)N2)Cl |
Computed by PubChem (NCBI)