CAS 5493-95-8 appears in our catalog under these names: 6-phenylmorpholin-3-one, 95%, 6-Phenylmorpholin-3-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
6-phenylmorpholin-3-one (CAS 5493-95-8) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 6-phenylmorpholin-3-one. InChIKey: RTQVWPLQBMKYGK-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 6-phenylmorpholin-3-one |
| InChIKey | RTQVWPLQBMKYGK-UHFFFAOYSA-N |
| SMILES | C1C(OCC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)