CAS 54945-13-0 is the registry number for 3-(4-Nitrophenyl)-1H-pyrazol-5(4H)-one, 99.96%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 250 mg, 10 mg, 5 mg, 500 mg, 25 mg.
3-(4-nitrophenyl)-1,4-dihydropyrazol-5-one (CAS 54945-13-0) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 3-(4-nitrophenyl)-1,4-dihydropyrazol-5-one. InChIKey: JKHLBOGGRVDLGP-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-1,4-dihydropyrazol-5-one |
| InChIKey | JKHLBOGGRVDLGP-UHFFFAOYSA-N |
| SMILES | C1C(=NNC1=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)