CAS 54970-96-6 is the registry number for 7-Methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine (CAS 54970-96-6) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine. InChIKey: ZJQYLKVDBSTLMC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 7-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine |
| InChIKey | ZJQYLKVDBSTLMC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)