CAS 550-60-7 appears in our catalog under these names: 1-Nitro-2-naphthol, 97%, 1–Nitro–2–naphthol, 1-Nitro-2-naphthol, >98.0%(GC)(T), 1-Nitro-2-naphthol, 1-Nitronaphthalen-2-ol 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 25g, 5g, 10g, 250mg, 1g, 200mg, 10000mg, 5000mg.
1-nitronaphthalen-2-ol (CAS 550-60-7) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 1-nitronaphthalen-2-ol. InChIKey: SSHIVHKMGVBXTJ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-nitronaphthalen-2-ol |
| InChIKey | SSHIVHKMGVBXTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)