CAS 55004-77-8 appears in our catalog under these names: 4-Hydroxy-6,7-dimethylcoumarin, 95%, 4-Hydroxy-6,7-dimethyl-2H-chromen-2-one. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-hydroxy-6,7-dimethylchromen-2-one (CAS 55004-77-8) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 4-hydroxy-6,7-dimethylchromen-2-one. InChIKey: AYHZQBMBPNZPEY-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-hydroxy-6,7-dimethylchromen-2-one |
| InChIKey | AYHZQBMBPNZPEY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC(=O)C=C2O |
Computed by PubChem (NCBI)