Products 55038-27-2
CAS 55038-27-2 is the registry number for Sarcophine. Offered by: Chemat, MedChemExpress. Available pack sizes: 10mg, 2mg, Get quote.
(1S,2E,6S,8S,11E)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one (CAS 55038-27-2) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (1S,2E,6S,8S,11E)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one. InChIKey: CGAKBBMRMLAYMY-BUHUPKIQSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (1S,2E,6S,8S,11E)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-17-one |
| InChIKey | CGAKBBMRMLAYMY-BUHUPKIQSA-N |
| SMILES | C/C/1=C\CC[C@]2([C@@H](O2)CC/C(=C/[C@H]3C(=C(C(=O)O3)C)CC1)/C)C |
Computed by PubChem (NCBI)