CAS 55108-28-6 appears in our catalog under these names: 1-(3-Acetyl-2-hydroxy-5-methyl-phenyl)ethanone, >95% (HPLC), 1,1'-(2-Hydroxy-5-methyl-1,3-phenylene)diethanone, 1,1'-(2-Hydroxy-5-methyl-1,3-phenylene)diethanone, 98%, 98%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 5g.
1-(3-acetyl-2-hydroxy-5-methylphenyl)ethanone (CAS 55108-28-6) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 1-(3-acetyl-2-hydroxy-5-methylphenyl)ethanone. InChIKey: ZZKCEQUZROPKJT-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-(3-acetyl-2-hydroxy-5-methylphenyl)ethanone |
| InChIKey | ZZKCEQUZROPKJT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)C)O)C(=O)C |
Computed by PubChem (NCBI)