Products 55144-92-8
CAS 55144-92-8 appears in our catalog under these names: 3–(2,4–Dichlorophenyl)propionic acid, 3-(2,4-Dichlorophenyl)propionic acid 98%, 3-(2,4-Dichlorophenyl)propionic acid, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
3-(2,4-dichlorophenyl)propanoic acid (CAS 55144-92-8) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)propanoic acid. InChIKey: HLNPVFSCAMKIOD-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)propanoic acid |
| InChIKey | HLNPVFSCAMKIOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(2,4-dichlorophenyl)propanoic acid, 3-(2,4-Dichlorophenyl)propionic acid, Benzenepropanoic acid, 2,4-dichloro-, 2,4-dichloro-benzenepropanoic acid, 3-(2,4-Dichlorophenyl)propionic acid, 97%, Maybridge4_004135, HLNPVFSCAMKIOD-UHFFFAOYSA-N, 3-(2,4-di-chlorophenyl)propionic a, 3-(2,4-di-chlorophenyl)propionic acid, 3-(2,4-dichlorophenyl)-propionic acid