CAS 5516-88-1 is the registry number for Paspalic Acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg.
(6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid (CAS 5516-88-1) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: (6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid. InChIKey: RJNCJTROKRDRBW-TZMCWYRMSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (6aR,10aR)-7-methyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid |
| InChIKey | RJNCJTROKRDRBW-TZMCWYRMSA-N |
| SMILES | CN1CC(=C[C@H]2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)O |
Computed by PubChem (NCBI)