CAS 55171-60-3 appears in our catalog under these names: 2-Bromoveratraldehyde, >95% (HPLC), 2–Bromo–3,4–dimethoxybenzaldehyde, 2-Bromo-3,4-dimethoxybenzaldehyde, 2-Bromo-3,4-dimethoxybenzaldehyde 95%, 2-Bromo-3,4-dimethoxybenzaldehyde, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g.
2-bromo-3,4-dimethoxybenzaldehyde (CAS 55171-60-3) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-3,4-dimethoxybenzaldehyde. InChIKey: BWFRHSRQIKGLLM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-3,4-dimethoxybenzaldehyde |
| InChIKey | BWFRHSRQIKGLLM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)Br)OC |
Computed by PubChem (NCBI)