CAS 55185-77-8 appears in our catalog under these names: 5-Phenyl-6H-1,3,4-thiadiazin-2-amine, 95%, 5-Phenyl-6H-1,3,4-thiadiazin-2-amine, 5-PHENYL-6H-1,3,4-THIADIAZIN-2-AMINE, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
5-phenyl-6H-1,3,4-thiadiazin-2-amine (CAS 55185-77-8) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 5-phenyl-6H-1,3,4-thiadiazin-2-amine. InChIKey: SCQDMIFRQDAQPV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 5-phenyl-6H-1,3,4-thiadiazin-2-amine |
| InChIKey | SCQDMIFRQDAQPV-UHFFFAOYSA-N |
| SMILES | C1C(=NN=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)