CAS 58954-39-5 is the registry number for 5-Phenyl-6h-1,3,4-thiadiazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
5-phenyl-6H-1,3,4-thiadiazin-2-amine (CAS 58954-39-5) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 5-phenyl-6H-1,3,4-thiadiazin-2-amine. InChIKey: SCQDMIFRQDAQPV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 5-phenyl-6H-1,3,4-thiadiazin-2-amine |
| InChIKey | SCQDMIFRQDAQPV-UHFFFAOYSA-N |
| SMILES | C1C(=NN=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)