Products 552-00-1
CAS 552-00-1 appears in our catalog under these names: Isobellidifolin, Isobellidifolin, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg.
1,3,8-trihydroxy-5-methoxyxanthen-9-one (CAS 552-00-1) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 1,3,8-trihydroxy-5-methoxyxanthen-9-one. InChIKey: QNJCJDZKEAVOBJ-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 1,3,8-trihydroxy-5-methoxyxanthen-9-one |
| InChIKey | QNJCJDZKEAVOBJ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)O)C(=O)C3=C(C=C(C=C3O2)O)O |
Computed by PubChem (NCBI)