CAS 55215-57-1 appears in our catalog under these names: 3-Bromo-5-nitroaniline 95%, 3-Bromo-5-nitroaniline, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
3-bromo-5-nitroaniline (CAS 55215-57-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-5-nitroaniline. InChIKey: GWLFQPJKTXGLGD-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-5-nitroaniline |
| InChIKey | GWLFQPJKTXGLGD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)