CAS 55240-51-2 appears in our catalog under these names: 2–Phenylisonicotinic Acid, 2-Phenylisonicotinic acid, 98%, 2-Phenylisonicotinic acid 98%, 2-Phenylisonicotinic Acid, 98%, 98%, 2-(Phenyl)-isonicotinic acid, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-phenylpyridine-4-carboxylic acid (CAS 55240-51-2) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-phenylpyridine-4-carboxylic acid. InChIKey: OMMKWOVBOKXXQU-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-phenylpyridine-4-carboxylic acid |
| InChIKey | OMMKWOVBOKXXQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)