CAS 55241-49-1 appears in our catalog under these names: 1,3-Dimethyl-2-oxo-5-benzimidazolinecarboxaldehyde, 1,3–Dimethyl–2–oxo–2,3–dihydro–1H–benzo(d)imidazole–5–carbaldehyde, 1,3-dimethyl-2-oxobenzimidazole-5-carbaldehyde/ 99.87% (existing batch purity), 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carbaldehyde 95%, 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-carbaldehyde, 95%, 95%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 2,5g, 100mg, 25mg, 50mg, 200mg, 250mg, 1g, 5g.
1,3-dimethyl-2-oxobenzimidazole-5-carbaldehyde (CAS 55241-49-1) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1,3-dimethyl-2-oxobenzimidazole-5-carbaldehyde. InChIKey: PFRNWHRHGONGPG-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1,3-dimethyl-2-oxobenzimidazole-5-carbaldehyde |
| InChIKey | PFRNWHRHGONGPG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)N(C1=O)C |
Computed by PubChem (NCBI)