CAS 55323-83-6 is the registry number for 6-Phenyl-2H-1,3-oxazine-2,4(3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-phenyl-1,3-oxazine-2,4-dione (CAS 55323-83-6) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 6-phenyl-1,3-oxazine-2,4-dione. InChIKey: TUHRSLFVEJPHTH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 6-phenyl-1,3-oxazine-2,4-dione |
| InChIKey | TUHRSLFVEJPHTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC(=O)O2 |
Computed by PubChem (NCBI)