CAS 55327-67-8 is the registry number for 1,3,5-Trimethyl-2,3-dihydro-1H-1,3-benzodiazol-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1,3,5-trimethylbenzimidazol-2-one (CAS 55327-67-8) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1,3,5-trimethylbenzimidazol-2-one. InChIKey: ZKTCCUHXIBVVNU-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1,3,5-trimethylbenzimidazol-2-one |
| InChIKey | ZKTCCUHXIBVVNU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=O)N2C)C |
Computed by PubChem (NCBI)