Products 55415-33-3

CAS 55415-33-3 is the registry number for 4-Acetamido-2-bromobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-acetamido-2-bromobenzoic acid (CAS 55415-33-3) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 4-acetamido-2-bromobenzoic acid. InChIKey: XHSQBNFXEBVXOE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrNO3
Molecular weight258.07 g/mol
IUPAC name4-acetamido-2-bromobenzoic acid
InChIKeyXHSQBNFXEBVXOE-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC(=C(C=C1)C(=O)O)Br

Computed by PubChem (NCBI)