CAS 55432-25-2 appears in our catalog under these names: N–Cyclopentyl–2–nitroaniline, N-Cyclopentyl-2-nitroaniline, 95%, N-Cyclopentyl-2-nitroaniline, 95+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
N-cyclopentyl-2-nitroaniline (CAS 55432-25-2) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: N-cyclopentyl-2-nitroaniline. InChIKey: ZQLZSKZOTVXWNW-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | N-cyclopentyl-2-nitroaniline |
| InChIKey | ZQLZSKZOTVXWNW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)