CAS 554407-01-1 appears in our catalog under these names: 3-(1-(4-Ethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl)-3-oxopropanenitrile, 95%, 3-(1-(4-Ethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl)-3-oxopropanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-3-oxopropanenitrile (CAS 554407-01-1) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: 3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-3-oxopropanenitrile. InChIKey: NBZMKXURKAFORS-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 3-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-3-oxopropanenitrile |
| InChIKey | NBZMKXURKAFORS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N2C(=CC(=C2C)C(=O)CC#N)C |
Computed by PubChem (NCBI)