Products 55443-60-2
CAS 55443-60-2 appears in our catalog under these names: L–Tyrosine–13C9, L-TYROSINE-13C9, 98 ATOM % 13C, 95% CP, L-Tyrosine-13C9, 99.81%. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1mg, 5mg, 100MG, 5 mg, 10 mg.
(2S)-2-amino-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid (CAS 55443-60-2) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 190.12 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid. InChIKey: OUYCCCASQSFEME-ZNZHEFIISA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid |
| InChIKey | OUYCCCASQSFEME-ZNZHEFIISA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1[13CH2][13C@@H]([13C](=O)O)N)O |
Computed by PubChem (NCBI)