CAS 55453-89-9 appears in our catalog under these names: Olopatadine Impurity 6, 2-((4-(Carboxymethyl)phenoxy)methyl)benzoic acid 98%, 2-((4-(Carboxymethyl)phenoxy)methyl)benzoic acid, 98%, 98%, 2-((4-(Carboxymethyl)phenoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 25g, 100g, 10g.
2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid (CAS 55453-89-9) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid. InChIKey: BCYWXPITXHFIQM-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid |
| InChIKey | BCYWXPITXHFIQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=C(C=C2)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)