Products 5550-65-2
CAS 5550-65-2 is the registry number for (+)-N-Methylhernovine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6aS)-1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol (CAS 5550-65-2) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: (6aS)-1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol. InChIKey: ZBFSMPOCZMVCMC-LBPRGKRZSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (6aS)-1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
| InChIKey | ZBFSMPOCZMVCMC-LBPRGKRZSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)O)OC)OC)O |
Computed by PubChem (NCBI)