CAS 55579-76-5 appears in our catalog under these names: 5-(3,4-(METHYLENEDIOXY)PHENYL)-1,3-, 5–(3,4(METHYLENEDIOXY)PHENYL)–1,3–CYCLOHEXANEDIONE, 5-(3,4-(Methylenedioxy)phenyl)-cyclohexane-1,3-dione. Offered by: Sigma-Aldrich, GLPBio, Biosynth. Available pack sizes: 5G, 10g.
5-(1,3-benzodioxol-5-yl)cyclohexane-1,3-dione (CAS 55579-76-5) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)cyclohexane-1,3-dione. InChIKey: BNXUYPAIVILSTN-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)cyclohexane-1,3-dione |
| InChIKey | BNXUYPAIVILSTN-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)