CAS 6404-28-0 appears in our catalog under these names: Boc–Nle–OH, Boc-L-Nle-OH, Boc-Nle-OH 95%, BOC-NLE-OH, >=99.0%, Boc-Nle-OH, 95%, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 100 g, 25 g, 500 g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 6404-28-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: ZIOCIQJXEKFHJO-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | ZIOCIQJXEKFHJO-QMMMGPOBSA-N |
| SMILES | CCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)