Products 55676-76-1
CAS 55676-76-1 is the registry number for Dimethyl biphenyl-3,4'-dicarboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl 3-(4-methoxycarbonylphenyl)benzoate (CAS 55676-76-1) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: methyl 3-(4-methoxycarbonylphenyl)benzoate. InChIKey: WECHJLDENFZQRV-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | methyl 3-(4-methoxycarbonylphenyl)benzoate |
| InChIKey | WECHJLDENFZQRV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Biphenyl]-3,4'-dicarboxylic acid, dimethyl ester, (1,1'-Biphenyl)-3,4'-dicarboxylic acid, dimethyl ester, (1,1'-Biphenyl)-3,4'-dicarboxylic acid, 3,4'-dimethyl ester, [1,1'-Biphenyl]-3,4'-dicarboxylic acid, 3,4'-dimethyl ester, dimethyl biphenyl-3,4'-dicarboxylate, methyl 3-(4-methoxycarbonylphenyl)benzoate, Dimethyl [1,1'-biphenyl]-3,4'-dicarboxylate, Dimethyl (1,1'-biphenyl)-3,4'-dicarboxylate, dimethyl 3,4'-biphenyldicarboxylate, dimethylbiphenyl-3,4'-dicarboxylate