Products 55679-22-6
CAS 55679-22-6 appears in our catalog under these names: N-(3-Hydroxyphenyl)-2-furamide, 95%, N-(3-Hydroxyphenyl)-2-furamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
N-(3-hydroxyphenyl)furan-2-carboxamide (CAS 55679-22-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: N-(3-hydroxyphenyl)furan-2-carboxamide. InChIKey: YMMLYZBIXTXDLR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | N-(3-hydroxyphenyl)furan-2-carboxamide |
| InChIKey | YMMLYZBIXTXDLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)NC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)