CAS 55680-27-8 is the registry number for N,N-Diphenyl Sulfamide. Offered by: TRC. Available pack sizes: 250mg.
(N-sulfamoylanilino)benzene (CAS 55680-27-8) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: (N-sulfamoylanilino)benzene. InChIKey: JNRIMGJUBFEWOW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | (N-sulfamoylanilino)benzene |
| InChIKey | JNRIMGJUBFEWOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)