CAS 55695-51-7 appears in our catalog under these names: (4-Chlorophenyl)-4-piperidinylmethanone Hydrochloride, (4–Chlorophenyl)(4–piperidyl)methanone HCl, (4-Chlorophenyl)(4-piperidyl)methanone hydrochloride, 95% , (4-Chlorophenyl)(piperidin-4-yl)methanone hydrochloride 97%, (4-Chlorophenyl)(piperidin-4-yl)methanone hydrochloride, 98%, 98%. Offered by: TRC, GLPBio, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 1g, 2g, 500mg, 5g, 250MG, 10g, 25g.
(4-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 55695-51-7) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (4-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: LZUYKOBTHSPKED-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (4-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | LZUYKOBTHSPKED-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)