Products 55752-05-1

CAS 55752-05-1 is the registry number for 4,5-Dimethoxy-2-methylbenzeneethanamine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.

Structural formula: {0} (CAS {1})

2-(4,5-dimethoxy-2-methylphenyl)ethanamine;hydrochloride (CAS 55752-05-1) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: 2-(4,5-dimethoxy-2-methylphenyl)ethanamine;hydrochloride. InChIKey: ODBURCHEUUMLGD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18ClNO2
Molecular weight231.72 g/mol
IUPAC name2-(4,5-dimethoxy-2-methylphenyl)ethanamine;hydrochloride
InChIKeyODBURCHEUUMLGD-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1CCN)OC)OC.Cl

Computed by PubChem (NCBI)